C27H35F4N5O5S — CID 70831630
(1S,4R,6S,7Z,14S)-N-(dimethylsulfamoyl)-14-[3-fluoro-5-(trifluoromethyl)anilino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide (PubChem CID 70831630) has the molecular formula C27H35F4N5O5S and a molecular weight of 617.67 g/mol. Its IUPAC name is (1S,4R,6S,7Z,14S)-N-(dimethylsulfamoyl)-14-[3-fluoro-5-(trifluoromethyl)anilino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide.
| Compound Name | (1S,4R,6S,7Z,14S)-N-(dimethylsulfamoyl)-14-[3-fluoro-5-(trifluoromethyl)anilino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide |
|---|---|
| PubChem CID | 70831630 |
| Molecular Formula | C27H35F4N5O5S |
| Molecular Weight | 617.67 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | (1S,4R,6S,7Z,14S)-N-(dimethylsulfamoyl)-14-[3-fluoro-5-(trifluoromethyl)anilino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide |
| SMILES | CN(C)S(=O)(=O)NC(=O)[C@@]12C[C@H]1/C=C\CCCCC[C@H](Nc1cc(F)cc(C(F)(F)F)c1)C(=O)N1CCC[C@H]1C(=O)N2 |
| InChI | InChI=1S/C27H35F4N5O5S/c1-35(2)42(40,41)34-25(39)26-16-17(26)9-6-4-3-5-7-10-21(24(38)36-12-8-11-22(36)23(37)33-26)32-20-14-18(27(29,30)31)13-19(28)15-20/h6,9,13-15,17,21-22,32H,3-5,7-8,10-12,16H2,1-2H3,(H,33,37)(H,34,39)/b9-6-/t17-,21+,22+,26-/m1/s1 |
| InChIKey | PJXPHGICVZCDCE-TXVUYUAISA-N |
| XLogP | 2.93 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.67 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|