C20H22N4OS — CID 77496241
N-[1-(2-cyano-4-thiophen-3-ylphenyl)pyrrolidin-3-yl]pyrrolidine-2-carboxamide (PubChem CID 77496241) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is N-[1-(2-cyano-4-thiophen-3-ylphenyl)pyrrolidin-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | N-[1-(2-cyano-4-thiophen-3-ylphenyl)pyrrolidin-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 77496241 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-[1-(2-cyano-4-thiophen-3-ylphenyl)pyrrolidin-3-yl]pyrrolidine-2-carboxamide |
| SMILES | N#Cc1cc(-c2ccsc2)ccc1N1CCC(NC(=O)C2CCCN2)C1 |
| InChI | InChI=1S/C20H22N4OS/c21-11-16-10-14(15-6-9-26-13-15)3-4-19(16)24-8-5-17(12-24)23-20(25)18-2-1-7-22-18/h3-4,6,9-10,13,17-18,22H,1-2,5,7-8,12H2,(H,23,25) |
| InChIKey | GEJQUYHDOYULCO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |