C9H17N3S — CID 775005
5-cyclohexyl-1,3,5-triazinane-2-thione (PubChem CID 775005) has the molecular formula C9H17N3S and a molecular weight of 199.32 g/mol. Its IUPAC name is 5-cyclohexyl-1,3,5-triazinane-2-thione.
| Compound Name | 5-cyclohexyl-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 775005 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 5-cyclohexyl-1,3,5-triazinane-2-thione |
| SMILES | S=C1NCN(C2CCCCC2)CN1 |
| InChI | InChI=1S/C9H17N3S/c13-9-10-6-12(7-11-9)8-4-2-1-3-5-8/h8H,1-7H2,(H2,10,11,13) |
| InChIKey | NYIFUCGHCMSJJP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|