About 5-cyclohexyl-1,3,5-triazinane-2-thione
5-cyclohexyl-1,3,5-triazinane-2-thione (PubChem CID 775005) has the molecular formula C9H17N3S
and a molecular weight of 199.32 g/mol. Its IUPAC name is 5-cyclohexyl-1,3,5-triazinane-2-thione.
Molecular Properties
| Compound Name | 5-cyclohexyl-1,3,5-triazinane-2-thione |
| PubChem CID | 775005 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 5-cyclohexyl-1,3,5-triazinane-2-thione |
| SMILES | S=C1NCN(C2CCCCC2)CN1 |
| InChI | InChI=1S/C9H17N3S/c13-9-10-6-12(7-11-9)8-4-2-1-3-5-8/h8H,1-7H2,(H2,10,11,13) |
| InChIKey | NYIFUCGHCMSJJP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclohexyl-1,3,5-triazinane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexyl-1,3,5-triazinane-2-thione?
The IUPAC name of 5-cyclohexyl-1,3,5-triazinane-2-thione (CID 775005) is 5-cyclohexyl-1,3,5-triazinane-2-thione.
What is the SMILES notation for 5-cyclohexyl-1,3,5-triazinane-2-thione?
The canonical SMILES for 5-cyclohexyl-1,3,5-triazinane-2-thione is S=C1NCN(C2CCCCC2)CN1.
What is the InChIKey of 5-cyclohexyl-1,3,5-triazinane-2-thione?
The InChIKey is NYIFUCGHCMSJJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3S/c13-9-10-6-12(7-11-9)8-4-2-1-3-5-8/h8H,1-7H2,(H2,10,11,13).
What are the key properties of 5-cyclohexyl-1,3,5-triazinane-2-thione?
5-cyclohexyl-1,3,5-triazinane-2-thione has a molecular weight of 199.32 g/mol, XLogP of 1.01, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexyl-1,3,5-triazinane-2-thione is sourced from PubChem (CID 775005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).