C9H18N2S — CID 708395
3-cyclohexyl-1,1-dimethylthiourea (PubChem CID 708395) has the molecular formula C9H18N2S and a molecular weight of 186.32 g/mol. Its IUPAC name is 3-cyclohexyl-1,1-dimethylthiourea.
| Compound Name | 3-cyclohexyl-1,1-dimethylthiourea |
|---|---|
| PubChem CID | 708395 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 3-cyclohexyl-1,1-dimethylthiourea |
| SMILES | CN(C)C(=S)NC1CCCCC1 |
| InChI | InChI=1S/C9H18N2S/c1-11(2)9(12)10-8-6-4-3-5-7-8/h8H,3-7H2,1-2H3,(H,10,12) |
| InChIKey | QHVRTRGSAJGAQA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|