C15H30N2S — CID 724237
3-cyclohexyl-1,1-bis(2-methylpropyl)thiourea (PubChem CID 724237) has the molecular formula C15H30N2S and a molecular weight of 270.49 g/mol. Its IUPAC name is 3-cyclohexyl-1,1-bis(2-methylpropyl)thiourea.
| Compound Name | 3-cyclohexyl-1,1-bis(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 724237 |
| Molecular Formula | C15H30N2S |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 3-cyclohexyl-1,1-bis(2-methylpropyl)thiourea |
| SMILES | CC(C)CN(CC(C)C)C(=S)NC1CCCCC1 |
| InChI | InChI=1S/C15H30N2S/c1-12(2)10-17(11-13(3)4)15(18)16-14-8-6-5-7-9-14/h12-14H,5-11H2,1-4H3,(H,16,18) |
| InChIKey | RQQYMIYZTDXXRP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|