C4H6Br2O3S — CID 7750233
(3R,4S,5R)-4,5-dibromo-1,1-dioxothiolan-3-ol (PubChem CID 7750233) has the molecular formula C4H6Br2O3S and a molecular weight of 293.96 g/mol. Its IUPAC name is (3R,4S,5R)-4,5-dibromo-1,1-dioxothiolan-3-ol.
| Compound Name | (3R,4S,5R)-4,5-dibromo-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 7750233 |
| Molecular Formula | C4H6Br2O3S |
| Molecular Weight | 293.96 g/mol |
| Exact Mass | 291.84 |
| IUPAC Name | (3R,4S,5R)-4,5-dibromo-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)C[C@@H](O)[C@H](Br)[C@H]1Br |
| InChI | InChI=1S/C4H6Br2O3S/c5-3-2(7)1-10(8,9)4(3)6/h2-4,7H,1H2/t2-,3+,4+/m1/s1 |
| InChIKey | XDTMYGFCKXRSMK-UZBSEBFBSA-N |
| XLogP | 0.26 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.96 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|