C4H7BrO3S — CID 95066178
(2S,3R)-2-bromo-1,1-dioxothiolan-3-ol (PubChem CID 95066178) has the molecular formula C4H7BrO3S and a molecular weight of 215.07 g/mol. Its IUPAC name is (2S,3R)-2-bromo-1,1-dioxothiolan-3-ol.
| Compound Name | (2S,3R)-2-bromo-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 95066178 |
| Molecular Formula | C4H7BrO3S |
| Molecular Weight | 215.07 g/mol |
| Exact Mass | 213.93 |
| IUPAC Name | (2S,3R)-2-bromo-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CC[C@@H](O)[C@@H]1Br |
| InChI | InChI=1S/C4H7BrO3S/c5-4-3(6)1-2-9(4,7)8/h3-4,6H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | QSDYCRURVQRGJL-QWWZWVQMSA-N |
| XLogP | -0.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.07 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|