C20H25NO5 — CID 7751061
N-(4,5-dimethoxy-2-methylphenyl)-2-(2-propoxyphenoxy)acetamide (PubChem CID 7751061) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is N-(4,5-dimethoxy-2-methylphenyl)-2-(2-propoxyphenoxy)acetamide.
| Compound Name | N-(4,5-dimethoxy-2-methylphenyl)-2-(2-propoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 7751061 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-(4,5-dimethoxy-2-methylphenyl)-2-(2-propoxyphenoxy)acetamide |
| SMILES | CCCOc1ccccc1OCC(=O)Nc1cc(OC)c(OC)cc1C |
| InChI | InChI=1S/C20H25NO5/c1-5-10-25-16-8-6-7-9-17(16)26-13-20(22)21-15-12-19(24-4)18(23-3)11-14(15)2/h6-9,11-12H,5,10,13H2,1-4H3,(H,21,22) |
| InChIKey | RTXDBMJGJAJIQR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |