C21H25NO4S2 — CID 24581970
2-[4-(1,3-dithiolan-2-yl)-2-methoxyphenoxy]-N-(2-propoxyphenyl)acetamide (PubChem CID 24581970) has the molecular formula C21H25NO4S2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 2-[4-(1,3-dithiolan-2-yl)-2-methoxyphenoxy]-N-(2-propoxyphenyl)acetamide.
| Compound Name | 2-[4-(1,3-dithiolan-2-yl)-2-methoxyphenoxy]-N-(2-propoxyphenyl)acetamide |
|---|---|
| PubChem CID | 24581970 |
| Molecular Formula | C21H25NO4S2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 2-[4-(1,3-dithiolan-2-yl)-2-methoxyphenoxy]-N-(2-propoxyphenyl)acetamide |
| SMILES | CCCOc1ccccc1NC(=O)COc1ccc(C2SCCS2)cc1OC |
| InChI | InChI=1S/C21H25NO4S2/c1-3-10-25-17-7-5-4-6-16(17)22-20(23)14-26-18-9-8-15(13-19(18)24-2)21-27-11-12-28-21/h4-9,13,21H,3,10-12,14H2,1-2H3,(H,22,23) |
| InChIKey | SPHLFKHZCDVKGL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |