C19H18N2O3S2 — CID 7706398
N-(3-cyanophenyl)-2-[4-(1,3-dithiolan-2-yl)-2-methoxyphenoxy]acetamide (PubChem CID 7706398) has the molecular formula C19H18N2O3S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-[4-(1,3-dithiolan-2-yl)-2-methoxyphenoxy]acetamide.
| Compound Name | N-(3-cyanophenyl)-2-[4-(1,3-dithiolan-2-yl)-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 7706398 |
| Molecular Formula | C19H18N2O3S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | N-(3-cyanophenyl)-2-[4-(1,3-dithiolan-2-yl)-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(C2SCCS2)ccc1OCC(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C19H18N2O3S2/c1-23-17-10-14(19-25-7-8-26-19)5-6-16(17)24-12-18(22)21-15-4-2-3-13(9-15)11-20/h2-6,9-10,19H,7-8,12H2,1H3,(H,21,22) |
| InChIKey | BNSPNGSUHAEBET-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |