C21H25NO4S2 — CID 9371764
2-[4-(1,3-dithiolan-2-yl)-2-methoxyphenoxy]-N-[2-(3-methylphenoxy)ethyl]acetamide (PubChem CID 9371764) has the molecular formula C21H25NO4S2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 2-[4-(1,3-dithiolan-2-yl)-2-methoxyphenoxy]-N-[2-(3-methylphenoxy)ethyl]acetamide.
| Compound Name | 2-[4-(1,3-dithiolan-2-yl)-2-methoxyphenoxy]-N-[2-(3-methylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 9371764 |
| Molecular Formula | C21H25NO4S2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 2-[4-(1,3-dithiolan-2-yl)-2-methoxyphenoxy]-N-[2-(3-methylphenoxy)ethyl]acetamide |
| SMILES | COc1cc(C2SCCS2)ccc1OCC(=O)NCCOc1cccc(C)c1 |
| InChI | InChI=1S/C21H25NO4S2/c1-15-4-3-5-17(12-15)25-9-8-22-20(23)14-26-18-7-6-16(13-19(18)24-2)21-27-10-11-28-21/h3-7,12-13,21H,8-11,14H2,1-2H3,(H,22,23) |
| InChIKey | MQUMCULWYYUSEO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|