C15H11Cl2NO3 — CID 775158
2,3-dichloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)benzamide (PubChem CID 775158) has the molecular formula C15H11Cl2NO3 and a molecular weight of 324.16 g/mol. Its IUPAC name is 2,3-dichloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)benzamide.
| Compound Name | 2,3-dichloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)benzamide |
|---|---|
| PubChem CID | 775158 |
| Molecular Formula | C15H11Cl2NO3 |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 2,3-dichloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H11Cl2NO3/c16-11-3-1-2-10(14(11)17)15(19)18-9-4-5-12-13(8-9)21-7-6-20-12/h1-5,8H,6-7H2,(H,18,19) |
| InChIKey | NSDCAHILTQJLME-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |