C15H13NO3 — CID 730782
N-(2,3-dihydro-1,4-benzodioxin-6-yl)benzamide (PubChem CID 730782) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)benzamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)benzamide |
|---|---|
| PubChem CID | 730782 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)c1ccccc1 |
| InChI | InChI=1S/C15H13NO3/c17-15(11-4-2-1-3-5-11)16-12-6-7-13-14(10-12)19-9-8-18-13/h1-7,10H,8-9H2,(H,16,17) |
| InChIKey | DDWSMYWTXCCWEV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |