C23H21FN2O3 — CID 7752549
[2-(3-fluoroanilino)-2-oxoethyl] 2-(2,3-dimethylanilino)benzoate (PubChem CID 7752549) has the molecular formula C23H21FN2O3 and a molecular weight of 392.43 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] 2-(2,3-dimethylanilino)benzoate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] 2-(2,3-dimethylanilino)benzoate |
|---|---|
| PubChem CID | 7752549 |
| Molecular Formula | C23H21FN2O3 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] 2-(2,3-dimethylanilino)benzoate |
| SMILES | Cc1cccc(Nc2ccccc2C(=O)OCC(=O)Nc2cccc(F)c2)c1C |
| InChI | InChI=1S/C23H21FN2O3/c1-15-7-5-12-20(16(15)2)26-21-11-4-3-10-19(21)23(28)29-14-22(27)25-18-9-6-8-17(24)13-18/h3-13,26H,14H2,1-2H3,(H,25,27) |
| InChIKey | FGNIROATCCGNSO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |