C20H19NO7 — CID 7753461
[2-(2-acetylanilino)-2-oxoethyl] 2-(4-formyl-2-methoxyphenoxy)acetate (PubChem CID 7753461) has the molecular formula C20H19NO7 and a molecular weight of 385.37 g/mol. Its IUPAC name is [2-(2-acetylanilino)-2-oxoethyl] 2-(4-formyl-2-methoxyphenoxy)acetate.
| Compound Name | [2-(2-acetylanilino)-2-oxoethyl] 2-(4-formyl-2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 7753461 |
| Molecular Formula | C20H19NO7 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | [2-(2-acetylanilino)-2-oxoethyl] 2-(4-formyl-2-methoxyphenoxy)acetate |
| SMILES | COc1cc(C=O)ccc1OCC(=O)OCC(=O)Nc1ccccc1C(C)=O |
| InChI | InChI=1S/C20H19NO7/c1-13(23)15-5-3-4-6-16(15)21-19(24)11-28-20(25)12-27-17-8-7-14(10-22)9-18(17)26-2/h3-10H,11-12H2,1-2H3,(H,21,24) |
| InChIKey | PQRIQCMNYFARNR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|