C23H21NO6 — CID 7753506
[(2S)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 2-(4-formyl-2-methoxyphenoxy)acetate (PubChem CID 7753506) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is [(2S)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 2-(4-formyl-2-methoxyphenoxy)acetate.
| Compound Name | [(2S)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 2-(4-formyl-2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 7753506 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | [(2S)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 2-(4-formyl-2-methoxyphenoxy)acetate |
| SMILES | COc1cc(C=O)ccc1OCC(=O)O[C@@H](C)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H21NO6/c1-15(23(27)24-19-9-8-17-5-3-4-6-18(17)12-19)30-22(26)14-29-20-10-7-16(13-25)11-21(20)28-2/h3-13,15H,14H2,1-2H3,(H,24,27)/t15-/m0/s1 |
| InChIKey | OTQJLSJIHRBANW-HNNXBMFYSA-N |
| XLogP | 3.61 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|