C22H23NO6 — CID 8988355
[(2S)-1-(2,3-dihydro-1H-inden-5-ylamino)-1-oxopropan-2-yl] 2-(4-formyl-2-methoxyphenoxy)acetate (PubChem CID 8988355) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is [(2S)-1-(2,3-dihydro-1H-inden-5-ylamino)-1-oxopropan-2-yl] 2-(4-formyl-2-methoxyphenoxy)acetate.
| Compound Name | [(2S)-1-(2,3-dihydro-1H-inden-5-ylamino)-1-oxopropan-2-yl] 2-(4-formyl-2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 8988355 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | [(2S)-1-(2,3-dihydro-1H-inden-5-ylamino)-1-oxopropan-2-yl] 2-(4-formyl-2-methoxyphenoxy)acetate |
| SMILES | COc1cc(C=O)ccc1OCC(=O)O[C@@H](C)C(=O)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C22H23NO6/c1-14(22(26)23-18-8-7-16-4-3-5-17(16)11-18)29-21(25)13-28-19-9-6-15(12-24)10-20(19)27-2/h6-12,14H,3-5,13H2,1-2H3,(H,23,26)/t14-/m0/s1 |
| InChIKey | UQXZZZVRARDZBB-AWEZNQCLSA-N |
| XLogP | 2.95 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|