C19H14N2O3S — CID 7755416
6-(2-quinolin-2-ylsulfanylacetyl)-4H-1,4-benzoxazin-3-one (PubChem CID 7755416) has the molecular formula C19H14N2O3S and a molecular weight of 350.40 g/mol. Its IUPAC name is 6-(2-quinolin-2-ylsulfanylacetyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(2-quinolin-2-ylsulfanylacetyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 7755416 |
| Molecular Formula | C19H14N2O3S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 6-(2-quinolin-2-ylsulfanylacetyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(C(=O)CSc3ccc4ccccc4n3)cc2N1 |
| InChI | InChI=1S/C19H14N2O3S/c22-16(13-5-7-17-15(9-13)20-18(23)10-24-17)11-25-19-8-6-12-3-1-2-4-14(12)21-19/h1-9H,10-11H2,(H,20,23) |
| InChIKey | HCULFGHALNWAGS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |