C21H14N4O5S — CID 6487542
6-[2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]acetyl]-4H-1,4-benzoxazin-3-one (PubChem CID 6487542) has the molecular formula C21H14N4O5S and a molecular weight of 434.43 g/mol. Its IUPAC name is 6-[2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]acetyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]acetyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 6487542 |
| Molecular Formula | C21H14N4O5S |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 6-[2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]acetyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(C(=O)CSc3nnc(-c4ccco4)c(-c4ccco4)n3)cc2N1 |
| InChI | InChI=1S/C21H14N4O5S/c26-14(12-5-6-15-13(9-12)22-18(27)10-30-15)11-31-21-23-19(16-3-1-7-28-16)20(24-25-21)17-4-2-8-29-17/h1-9H,10-11H2,(H,22,27) |
| InChIKey | DBICOBIIFBKYTF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 120.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_6_furan(4)', 'substructure': 'N/A'} |
|---|