C25H26N4O4S — CID 98292414
6-[2-[[4-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4H-1,4-benzoxazin-3-one (PubChem CID 98292414) has the molecular formula C25H26N4O4S and a molecular weight of 478.57 g/mol. Its IUPAC name is 6-[2-[[4-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-[[4-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 98292414 |
| Molecular Formula | C25H26N4O4S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 6-[2-[[4-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4H-1,4-benzoxazin-3-one |
| SMILES | C[C@H]([C@H]1C[C@H]2CC[C@H]1C2)n1c(SCC(=O)c2ccc3c(c2)NC(=O)CO3)nnc1-c1ccco1 |
| InChI | InChI=1S/C25H26N4O4S/c1-14(18-10-15-4-5-16(18)9-15)29-24(22-3-2-8-32-22)27-28-25(29)34-13-20(30)17-6-7-21-19(11-17)26-23(31)12-33-21/h2-3,6-8,11,14-16,18H,4-5,9-10,12-13H2,1H3,(H,26,31)/t14-,15+,16+,18-/m1/s1 |
| InChIKey | BMCCNHIDLGWCLF-MUQADHOPSA-N |
| XLogP | 4.84 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |