C26H33N5O4S2 — CID 129376273
2-[[4-[(1S)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(dimethylsulfamoyl)-4-methylphenyl]acetamide (PubChem CID 129376273) has the molecular formula C26H33N5O4S2 and a molecular weight of 543.72 g/mol. Its IUPAC name is 2-[[4-[(1S)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(dimethylsulfamoyl)-4-methylphenyl]acetamide.
| Compound Name | 2-[[4-[(1S)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(dimethylsulfamoyl)-4-methylphenyl]acetamide |
|---|---|
| PubChem CID | 129376273 |
| Molecular Formula | C26H33N5O4S2 |
| Molecular Weight | 543.72 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | 2-[[4-[(1S)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(dimethylsulfamoyl)-4-methylphenyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nnc(-c3ccco3)n2[C@@H](C)[C@@H]2C[C@H]3CC[C@H]2C3)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C26H33N5O4S2/c1-16-7-10-20(14-23(16)37(33,34)30(3)4)27-24(32)15-36-26-29-28-25(22-6-5-11-35-22)31(26)17(2)21-13-18-8-9-19(21)12-18/h5-7,10-11,14,17-19,21H,8-9,12-13,15H2,1-4H3,(H,27,32)/t17-,18-,19-,21-/m0/s1 |
| InChIKey | KAYXBJOEHKQJKX-IWFBPKFRSA-N |
| XLogP | 4.82 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.72 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |