C25H29N3O4S — CID 98299426
2-[[4-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-1-(3,4-dimethoxyphenyl)ethanone (PubChem CID 98299426) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is 2-[[4-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-1-(3,4-dimethoxyphenyl)ethanone.
| Compound Name | 2-[[4-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-1-(3,4-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 98299426 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 2-[[4-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-1-(3,4-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)CSc2nnc(-c3ccco3)n2[C@H](C)[C@H]2C[C@H]3CC[C@H]2C3)cc1OC |
| InChI | InChI=1S/C25H29N3O4S/c1-15(19-12-16-6-7-17(19)11-16)28-24(22-5-4-10-32-22)26-27-25(28)33-14-20(29)18-8-9-21(30-2)23(13-18)31-3/h4-5,8-10,13,15-17,19H,6-7,11-12,14H2,1-3H3/t15-,16+,17+,19-/m1/s1 |
| InChIKey | PRMWWNRKXKTDIJ-VUHPKUFZSA-N |
| XLogP | 5.53 |
| TPSA | 79.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |