About methyl 3-oxobutanoate
methyl 3-oxobutanoate (PubChem CID 7757) has the molecular formula C5H8O3
and a molecular weight of 116.12 g/mol. Its IUPAC name is methyl 3-oxobutanoate.
Molecular Properties
| Compound Name | methyl 3-oxobutanoate |
| PubChem CID | 7757 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | methyl 3-oxobutanoate |
| SMILES | COC(=O)CC(C)=O |
| InChI | InChI=1S/C5H8O3/c1-4(6)3-5(7)8-2/h3H2,1-2H3 |
| InChIKey | WRQNANDWMGAFTP-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-oxobutanoate?
The IUPAC name of methyl 3-oxobutanoate (CID 7757) is methyl 3-oxobutanoate.
What is the SMILES notation for methyl 3-oxobutanoate?
The canonical SMILES for methyl 3-oxobutanoate is COC(=O)CC(C)=O.
What is the InChIKey of methyl 3-oxobutanoate?
The InChIKey is WRQNANDWMGAFTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3/c1-4(6)3-5(7)8-2/h3H2,1-2H3.
What are the key properties of methyl 3-oxobutanoate?
methyl 3-oxobutanoate has a molecular weight of 116.12 g/mol, XLogP of 0.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-oxobutanoate is sourced from PubChem (CID 7757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).