C18H18N2O7 — CID 7759460
[2-(2,4-dimethoxyanilino)-2-oxoethyl] 3-methyl-4-nitrobenzoate (PubChem CID 7759460) has the molecular formula C18H18N2O7 and a molecular weight of 374.35 g/mol. Its IUPAC name is [2-(2,4-dimethoxyanilino)-2-oxoethyl] 3-methyl-4-nitrobenzoate.
| Compound Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 3-methyl-4-nitrobenzoate |
|---|---|
| PubChem CID | 7759460 |
| Molecular Formula | C18H18N2O7 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 3-methyl-4-nitrobenzoate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2ccc([N+](=O)[O-])c(C)c2)c(OC)c1 |
| InChI | InChI=1S/C18H18N2O7/c1-11-8-12(4-7-15(11)20(23)24)18(22)27-10-17(21)19-14-6-5-13(25-2)9-16(14)26-3/h4-9H,10H2,1-3H3,(H,19,21) |
| InChIKey | IOSMAKUSRRXLIO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|