C22H21NO4 — CID 7760740
[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 2-phenoxybenzoate (PubChem CID 7760740) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 2-phenoxybenzoate.
| Compound Name | [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 2-phenoxybenzoate |
|---|---|
| PubChem CID | 7760740 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 2-phenoxybenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccccc2Oc2ccccc2)c(C)n1C |
| InChI | InChI=1S/C22H21NO4/c1-15-13-19(16(2)23(15)3)20(24)14-26-22(25)18-11-7-8-12-21(18)27-17-9-5-4-6-10-17/h4-13H,14H2,1-3H3 |
| InChIKey | PNIIQVMKZSZIJM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |