C22H20FNO4 — CID 7768073
[2-(4-fluorophenyl)-2-oxoethyl] (E)-3-[1-(furan-2-ylmethyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate (PubChem CID 7768073) has the molecular formula C22H20FNO4 and a molecular weight of 381.40 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] (E)-3-[1-(furan-2-ylmethyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] (E)-3-[1-(furan-2-ylmethyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7768073 |
| Molecular Formula | C22H20FNO4 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] (E)-3-[1-(furan-2-ylmethyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
| SMILES | Cc1cc(/C=C/C(=O)OCC(=O)c2ccc(F)cc2)c(C)n1Cc1ccco1 |
| InChI | InChI=1S/C22H20FNO4/c1-15-12-18(16(2)24(15)13-20-4-3-11-27-20)7-10-22(26)28-14-21(25)17-5-8-19(23)9-6-17/h3-12H,13-14H2,1-2H3/b10-7+ |
| InChIKey | CSBXXMNNLXJLBA-JXMROGBWSA-N |
| XLogP | 4.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|