C25H29N3O3 — CID 8503780
N,N-diethyl-4-[[(E)-3-[1-(furan-2-ylmethyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoyl]amino]benzamide (PubChem CID 8503780) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is N,N-diethyl-4-[[(E)-3-[1-(furan-2-ylmethyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoyl]amino]benzamide.
| Compound Name | N,N-diethyl-4-[[(E)-3-[1-(furan-2-ylmethyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 8503780 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N,N-diethyl-4-[[(E)-3-[1-(furan-2-ylmethyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)/C=C/c2cc(C)n(Cc3ccco3)c2C)cc1 |
| InChI | InChI=1S/C25H29N3O3/c1-5-27(6-2)25(30)20-9-12-22(13-10-20)26-24(29)14-11-21-16-18(3)28(19(21)4)17-23-8-7-15-31-23/h7-16H,5-6,17H2,1-4H3,(H,26,29)/b14-11+ |
| InChIKey | VIFPGBUXOKRUEK-SDNWHVSQSA-N |
| XLogP | 4.88 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|