C13H26N2O2S — CID 777513
1-ethylsulfonyl-4-[(1S,3R)-3-methylcyclohexyl]piperazine (PubChem CID 777513) has the molecular formula C13H26N2O2S and a molecular weight of 274.43 g/mol. Its IUPAC name is 1-ethylsulfonyl-4-[(1S,3R)-3-methylcyclohexyl]piperazine.
| Compound Name | 1-ethylsulfonyl-4-[(1S,3R)-3-methylcyclohexyl]piperazine |
|---|---|
| PubChem CID | 777513 |
| Molecular Formula | C13H26N2O2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-ethylsulfonyl-4-[(1S,3R)-3-methylcyclohexyl]piperazine |
| SMILES | CCS(=O)(=O)N1CCN([C@H]2CCC[C@@H](C)C2)CC1 |
| InChI | InChI=1S/C13H26N2O2S/c1-3-18(16,17)15-9-7-14(8-10-15)13-6-4-5-12(2)11-13/h12-13H,3-11H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | DSKJNSAMSJTGHR-OLZOCXBDSA-N |
| XLogP | 1.53 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |