C21H25FN3O2+ — CID 7777035
(1S,2S,6R,7R)-4-[[4-(4-fluorophenyl)piperazin-1-ium-1-yl]methyl]-8-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 7777035) has the molecular formula C21H25FN3O2+ and a molecular weight of 370.45 g/mol. Its IUPAC name is (1S,2S,6R,7R)-4-[[4-(4-fluorophenyl)piperazin-1-ium-1-yl]methyl]-8-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2S,6R,7R)-4-[[4-(4-fluorophenyl)piperazin-1-ium-1-yl]methyl]-8-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 7777035 |
| Molecular Formula | C21H25FN3O2+ |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (1S,2S,6R,7R)-4-[[4-(4-fluorophenyl)piperazin-1-ium-1-yl]methyl]-8-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC1=C[C@@H]2C[C@@H]1[C@H]1C(=O)N(C[NH+]3CCN(c4ccc(F)cc4)CC3)C(=O)[C@H]12 |
| InChI | InChI=1S/C21H24FN3O2/c1-13-10-14-11-17(13)19-18(14)20(26)25(21(19)27)12-23-6-8-24(9-7-23)16-4-2-15(22)3-5-16/h2-5,10,14,17-19H,6-9,11-12H2,1H3/p+1/t14-,17+,18+,19-/m1/s1 |
| InChIKey | GOOHOMUWULKGPI-GRGSLBFTSA-O |
| XLogP | 0.69 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|