C24H18N2O3S — CID 7778561
4-[(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-N-phenylbenzamide (PubChem CID 7778561) has the molecular formula C24H18N2O3S and a molecular weight of 414.49 g/mol. Its IUPAC name is 4-[(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-N-phenylbenzamide.
| Compound Name | 4-[(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 7778561 |
| Molecular Formula | C24H18N2O3S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 4-[(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(CN2c3cccc4cccc(c34)S2(=O)=O)cc1 |
| InChI | InChI=1S/C24H18N2O3S/c27-24(25-20-8-2-1-3-9-20)19-14-12-17(13-15-19)16-26-21-10-4-6-18-7-5-11-22(23(18)21)30(26,28)29/h1-15H,16H2,(H,25,27) |
| InChIKey | QZZNVTOBTYENOW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |