C27H23N3O3S — CID 5138939
4-[(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-N-(2-phenylpropylideneamino)benzamide (PubChem CID 5138939) has the molecular formula C27H23N3O3S and a molecular weight of 469.57 g/mol. Its IUPAC name is 4-[(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-N-(2-phenylpropylideneamino)benzamide.
| Compound Name | 4-[(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-N-(2-phenylpropylideneamino)benzamide |
|---|---|
| PubChem CID | 5138939 |
| Molecular Formula | C27H23N3O3S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 4-[(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-N-(2-phenylpropylideneamino)benzamide |
| SMILES | CC(C=NNC(=O)c1ccc(CN2c3cccc4cccc(c34)S2(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H23N3O3S/c1-19(21-7-3-2-4-8-21)17-28-29-27(31)23-15-13-20(14-16-23)18-30-24-11-5-9-22-10-6-12-25(26(22)24)34(30,32)33/h2-17,19H,18H2,1H3,(H,29,31) |
| InChIKey | VFRYNDGIUVMCLO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|