C21H22ClFN2O3 — CID 7781765
[(2S)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2-chloro-6-fluorobenzoate (PubChem CID 7781765) has the molecular formula C21H22ClFN2O3 and a molecular weight of 404.87 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2-chloro-6-fluorobenzoate.
| Compound Name | [(2S)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2-chloro-6-fluorobenzoate |
|---|---|
| PubChem CID | 7781765 |
| Molecular Formula | C21H22ClFN2O3 |
| Molecular Weight | 404.87 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | [(2S)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2-chloro-6-fluorobenzoate |
| SMILES | C[C@H](OC(=O)c1c(F)cccc1Cl)C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H22ClFN2O3/c1-14(28-21(27)19-17(22)6-5-7-18(19)23)20(26)24-15-8-10-16(11-9-15)25-12-3-2-4-13-25/h5-11,14H,2-4,12-13H2,1H3,(H,24,26)/t14-/m0/s1 |
| InChIKey | GVNQOCMLUOLTNZ-AWEZNQCLSA-N |
| XLogP | 4.65 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.87 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|