C22H27N3O3 — CID 7787750
3-(3-nitrophenyl)-1-phenyl-1-[(1S)-1-(2,2,3,3-tetramethylcyclopropyl)ethyl]urea (PubChem CID 7787750) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-1-phenyl-1-[(1S)-1-(2,2,3,3-tetramethylcyclopropyl)ethyl]urea.
| Compound Name | 3-(3-nitrophenyl)-1-phenyl-1-[(1S)-1-(2,2,3,3-tetramethylcyclopropyl)ethyl]urea |
|---|---|
| PubChem CID | 7787750 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 3-(3-nitrophenyl)-1-phenyl-1-[(1S)-1-(2,2,3,3-tetramethylcyclopropyl)ethyl]urea |
| SMILES | C[C@@H](C1C(C)(C)C1(C)C)N(C(=O)Nc1cccc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C22H27N3O3/c1-15(19-21(2,3)22(19,4)5)24(17-11-7-6-8-12-17)20(26)23-16-10-9-13-18(14-16)25(27)28/h6-15,19H,1-5H3,(H,23,26)/t15-/m0/s1 |
| InChIKey | VKURIQGWIYXQRT-HNNXBMFYSA-N |
| XLogP | 5.70 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|