C18H25NO5 — CID 7791219
[2-(cyclopentylamino)-2-oxoethyl] 2-(2-propoxyphenoxy)acetate (PubChem CID 7791219) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 2-(2-propoxyphenoxy)acetate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 2-(2-propoxyphenoxy)acetate |
|---|---|
| PubChem CID | 7791219 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 2-(2-propoxyphenoxy)acetate |
| SMILES | CCCOc1ccccc1OCC(=O)OCC(=O)NC1CCCC1 |
| InChI | InChI=1S/C18H25NO5/c1-2-11-22-15-9-5-6-10-16(15)23-13-18(21)24-12-17(20)19-14-7-3-4-8-14/h5-6,9-10,14H,2-4,7-8,11-13H2,1H3,(H,19,20) |
| InChIKey | UKOYGFDKOFNFJO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |