C15H22N2O4S2 — CID 7795593
N-[(2S)-butan-2-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide (PubChem CID 7795593) has the molecular formula C15H22N2O4S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide.
| Compound Name | N-[(2S)-butan-2-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 7795593 |
| Molecular Formula | C15H22N2O4S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | N-[(2S)-butan-2-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide |
| SMILES | CC[C@H](C)N(C(=O)CSc1cccc[n+]1[O-])[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H22N2O4S2/c1-3-12(2)17(13-7-9-23(20,21)11-13)14(18)10-22-15-6-4-5-8-16(15)19/h4-6,8,12-13H,3,7,9-11H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | RAZWKNPOHSFQRA-STQMWFEESA-N |
| XLogP | 1.23 |
| TPSA | 81.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|