C14H20N2O5S2 — CID 9288705
N-[(3S)-1,1-dioxothiolan-3-yl]-N-(2-methoxyethyl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide (PubChem CID 9288705) has the molecular formula C14H20N2O5S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-N-(2-methoxyethyl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-(2-methoxyethyl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 9288705 |
| Molecular Formula | C14H20N2O5S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-(2-methoxyethyl)-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide |
| SMILES | COCCN(C(=O)CSc1cccc[n+]1[O-])[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H20N2O5S2/c1-21-8-7-15(12-5-9-23(19,20)11-12)13(17)10-22-14-4-2-3-6-16(14)18/h2-4,6,12H,5,7-11H2,1H3/t12-/m0/s1 |
| InChIKey | OWCOMLVODGFXFR-LBPRGKRZSA-N |
| XLogP | 0.07 |
| TPSA | 90.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|