C17H11FN2O6 — CID 7796962
(2-fluorophenyl)methyl 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 7796962) has the molecular formula C17H11FN2O6 and a molecular weight of 358.28 g/mol. Its IUPAC name is (2-fluorophenyl)methyl 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | (2-fluorophenyl)methyl 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 7796962 |
| Molecular Formula | C17H11FN2O6 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | (2-fluorophenyl)methyl 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)OCc1ccccc1F |
| InChI | InChI=1S/C17H11FN2O6/c18-14-4-2-1-3-10(14)9-26-15(21)8-19-16(22)12-6-5-11(20(24)25)7-13(12)17(19)23/h1-7H,8-9H2 |
| InChIKey | VHDNBIRSXDNYTR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|