C19H16ClN3O4 — CID 7797570
[2-[[3-(4-chlorophenyl)-1-methylpyrazol-5-yl]amino]-2-oxoethyl] 2-hydroxybenzoate (PubChem CID 7797570) has the molecular formula C19H16ClN3O4 and a molecular weight of 385.81 g/mol. Its IUPAC name is [2-[[3-(4-chlorophenyl)-1-methylpyrazol-5-yl]amino]-2-oxoethyl] 2-hydroxybenzoate.
| Compound Name | [2-[[3-(4-chlorophenyl)-1-methylpyrazol-5-yl]amino]-2-oxoethyl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 7797570 |
| Molecular Formula | C19H16ClN3O4 |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | [2-[[3-(4-chlorophenyl)-1-methylpyrazol-5-yl]amino]-2-oxoethyl] 2-hydroxybenzoate |
| SMILES | Cn1nc(-c2ccc(Cl)cc2)cc1NC(=O)COC(=O)c1ccccc1O |
| InChI | InChI=1S/C19H16ClN3O4/c1-23-17(10-15(22-23)12-6-8-13(20)9-7-12)21-18(25)11-27-19(26)14-4-2-3-5-16(14)24/h2-10,24H,11H2,1H3,(H,21,25) |
| InChIKey | JEMQRRLBKWBPLT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |