C15H15ClN2O3 — CID 7798583
[(1S)-1-cyanoethyl] (3R)-1-[(2-chlorophenyl)methyl]-5-oxopyrrolidine-3-carboxylate (PubChem CID 7798583) has the molecular formula C15H15ClN2O3 and a molecular weight of 306.75 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl] (3R)-1-[(2-chlorophenyl)methyl]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [(1S)-1-cyanoethyl] (3R)-1-[(2-chlorophenyl)methyl]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7798583 |
| Molecular Formula | C15H15ClN2O3 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | [(1S)-1-cyanoethyl] (3R)-1-[(2-chlorophenyl)methyl]-5-oxopyrrolidine-3-carboxylate |
| SMILES | C[C@@H](C#N)OC(=O)[C@@H]1CC(=O)N(Cc2ccccc2Cl)C1 |
| InChI | InChI=1S/C15H15ClN2O3/c1-10(7-17)21-15(20)12-6-14(19)18(9-12)8-11-4-2-3-5-13(11)16/h2-5,10,12H,6,8-9H2,1H3/t10-,12+/m0/s1 |
| InChIKey | MGAVMVMEJJNLLV-CMPLNLGQSA-N |
| XLogP | 2.14 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |