C20H17ClN2O3 — CID 8509589
(2-cyanophenyl)methyl (3R)-1-[(2-chlorophenyl)methyl]-5-oxopyrrolidine-3-carboxylate (PubChem CID 8509589) has the molecular formula C20H17ClN2O3 and a molecular weight of 368.82 g/mol. Its IUPAC name is (2-cyanophenyl)methyl (3R)-1-[(2-chlorophenyl)methyl]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (2-cyanophenyl)methyl (3R)-1-[(2-chlorophenyl)methyl]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 8509589 |
| Molecular Formula | C20H17ClN2O3 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | (2-cyanophenyl)methyl (3R)-1-[(2-chlorophenyl)methyl]-5-oxopyrrolidine-3-carboxylate |
| SMILES | N#Cc1ccccc1COC(=O)[C@@H]1CC(=O)N(Cc2ccccc2Cl)C1 |
| InChI | InChI=1S/C20H17ClN2O3/c21-18-8-4-3-6-15(18)11-23-12-17(9-19(23)24)20(25)26-13-16-7-2-1-5-14(16)10-22/h1-8,17H,9,11-13H2/t17-/m1/s1 |
| InChIKey | MRDYFEJYDHVWJH-QGZVFWFLSA-N |
| XLogP | 3.30 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |