C23H31N3O3 — CID 7799897
N-[(1R)-3-[2-[2-(1-adamantyl)acetyl]hydrazinyl]-3-oxo-1-phenylpropyl]acetamide (PubChem CID 7799897) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[(1R)-3-[2-[2-(1-adamantyl)acetyl]hydrazinyl]-3-oxo-1-phenylpropyl]acetamide.
| Compound Name | N-[(1R)-3-[2-[2-(1-adamantyl)acetyl]hydrazinyl]-3-oxo-1-phenylpropyl]acetamide |
|---|---|
| PubChem CID | 7799897 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | N-[(1R)-3-[2-[2-(1-adamantyl)acetyl]hydrazinyl]-3-oxo-1-phenylpropyl]acetamide |
| SMILES | CC(=O)N[C@H](CC(=O)NNC(=O)CC12CC3CC(CC(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C23H31N3O3/c1-15(27)24-20(19-5-3-2-4-6-19)10-21(28)25-26-22(29)14-23-11-16-7-17(12-23)9-18(8-16)13-23/h2-6,16-18,20H,7-14H2,1H3,(H,24,27)(H,25,28)(H,26,29)/t16?,17?,18?,20-,23?/m1/s1 |
| InChIKey | YYDHQAZNLFNXNL-ZTLYHTANSA-N |
| XLogP | 3.01 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|