C21H28N2O3 — CID 7742298
(2R)-N'-[2-(1-adamantyl)acetyl]-2-phenoxypropanehydrazide (PubChem CID 7742298) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is (2R)-N'-[2-(1-adamantyl)acetyl]-2-phenoxypropanehydrazide.
| Compound Name | (2R)-N'-[2-(1-adamantyl)acetyl]-2-phenoxypropanehydrazide |
|---|---|
| PubChem CID | 7742298 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (2R)-N'-[2-(1-adamantyl)acetyl]-2-phenoxypropanehydrazide |
| SMILES | C[C@@H](Oc1ccccc1)C(=O)NNC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H28N2O3/c1-14(26-18-5-3-2-4-6-18)20(25)23-22-19(24)13-21-10-15-7-16(11-21)9-17(8-15)12-21/h2-6,14-17H,7-13H2,1H3,(H,22,24)(H,23,25)/t14-,15?,16?,17?,21?/m1/s1 |
| InChIKey | GEQMCDCQHNVTJS-LFPRZYRFSA-N |
| XLogP | 3.21 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|