C16H23F3N2O2 — CID 75533847
N'-[2-(1-adamantyl)acetyl]-3,3,3-trifluoro-2-methylpropanehydrazide (PubChem CID 75533847) has the molecular formula C16H23F3N2O2 and a molecular weight of 332.37 g/mol. Its IUPAC name is N'-[2-(1-adamantyl)acetyl]-3,3,3-trifluoro-2-methylpropanehydrazide.
| Compound Name | N'-[2-(1-adamantyl)acetyl]-3,3,3-trifluoro-2-methylpropanehydrazide |
|---|---|
| PubChem CID | 75533847 |
| Molecular Formula | C16H23F3N2O2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N'-[2-(1-adamantyl)acetyl]-3,3,3-trifluoro-2-methylpropanehydrazide |
| SMILES | CC(C(=O)NNC(=O)CC12CC3CC(CC(C3)C1)C2)C(F)(F)F |
| InChI | InChI=1S/C16H23F3N2O2/c1-9(16(17,18)19)14(23)21-20-13(22)8-15-5-10-2-11(6-15)4-12(3-10)7-15/h9-12H,2-8H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | ODSQBCDSZMLHAO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|