C22H34N4O2 — CID 95777128
(2R)-N'-[2-(1-adamantyl)acetyl]-2-methyl-3-(1,3,5-trimethylpyrazol-4-yl)propanehydrazide (PubChem CID 95777128) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is (2R)-N'-[2-(1-adamantyl)acetyl]-2-methyl-3-(1,3,5-trimethylpyrazol-4-yl)propanehydrazide.
| Compound Name | (2R)-N'-[2-(1-adamantyl)acetyl]-2-methyl-3-(1,3,5-trimethylpyrazol-4-yl)propanehydrazide |
|---|---|
| PubChem CID | 95777128 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | (2R)-N'-[2-(1-adamantyl)acetyl]-2-methyl-3-(1,3,5-trimethylpyrazol-4-yl)propanehydrazide |
| SMILES | Cc1nn(C)c(C)c1C[C@@H](C)C(=O)NNC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H34N4O2/c1-13(5-19-14(2)25-26(4)15(19)3)21(28)24-23-20(27)12-22-9-16-6-17(10-22)8-18(7-16)11-22/h13,16-18H,5-12H2,1-4H3,(H,23,27)(H,24,28)/t13-,16?,17?,18?,22?/m1/s1 |
| InChIKey | OMGUIGCFEDDNAV-DOFBBEASSA-N |
| XLogP | 2.97 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|