C18H23ClN4O2S — CID 95777525
(2R)-N'-[2-(4-chlorophenyl)sulfanylacetyl]-2-methyl-3-(1,3,5-trimethylpyrazol-4-yl)propanehydrazide (PubChem CID 95777525) has the molecular formula C18H23ClN4O2S and a molecular weight of 394.93 g/mol. Its IUPAC name is (2R)-N'-[2-(4-chlorophenyl)sulfanylacetyl]-2-methyl-3-(1,3,5-trimethylpyrazol-4-yl)propanehydrazide.
| Compound Name | (2R)-N'-[2-(4-chlorophenyl)sulfanylacetyl]-2-methyl-3-(1,3,5-trimethylpyrazol-4-yl)propanehydrazide |
|---|---|
| PubChem CID | 95777525 |
| Molecular Formula | C18H23ClN4O2S |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (2R)-N'-[2-(4-chlorophenyl)sulfanylacetyl]-2-methyl-3-(1,3,5-trimethylpyrazol-4-yl)propanehydrazide |
| SMILES | Cc1nn(C)c(C)c1C[C@@H](C)C(=O)NNC(=O)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H23ClN4O2S/c1-11(9-16-12(2)22-23(4)13(16)3)18(25)21-20-17(24)10-26-15-7-5-14(19)6-8-15/h5-8,11H,9-10H2,1-4H3,(H,20,24)(H,21,25)/t11-/m1/s1 |
| InChIKey | CAHRHHUJBNRHCX-LLVKDONJSA-N |
| XLogP | 2.81 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|