C19H25ClN4O2S — CID 36850430
N'-[2-(4-chlorophenyl)sulfanylacetyl]-2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetohydrazide (PubChem CID 36850430) has the molecular formula C19H25ClN4O2S and a molecular weight of 408.96 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)sulfanylacetyl]-2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetohydrazide.
| Compound Name | N'-[2-(4-chlorophenyl)sulfanylacetyl]-2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetohydrazide |
|---|---|
| PubChem CID | 36850430 |
| Molecular Formula | C19H25ClN4O2S |
| Molecular Weight | 408.96 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N'-[2-(4-chlorophenyl)sulfanylacetyl]-2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetohydrazide |
| SMILES | Cc1nn(CC(C)C)c(C)c1CC(=O)NNC(=O)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H25ClN4O2S/c1-12(2)10-24-14(4)17(13(3)23-24)9-18(25)21-22-19(26)11-27-16-7-5-15(20)6-8-16/h5-8,12H,9-11H2,1-4H3,(H,21,25)(H,22,26) |
| InChIKey | WPXFWWRHVAMXNC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.96 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|