C21H27N3O4S — CID 55360255
N'-[2-(1-adamantyl)acetyl]-2-(4-nitrophenyl)sulfanylpropanehydrazide (PubChem CID 55360255) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is N'-[2-(1-adamantyl)acetyl]-2-(4-nitrophenyl)sulfanylpropanehydrazide.
| Compound Name | N'-[2-(1-adamantyl)acetyl]-2-(4-nitrophenyl)sulfanylpropanehydrazide |
|---|---|
| PubChem CID | 55360255 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | N'-[2-(1-adamantyl)acetyl]-2-(4-nitrophenyl)sulfanylpropanehydrazide |
| SMILES | CC(Sc1ccc([N+](=O)[O-])cc1)C(=O)NNC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H27N3O4S/c1-13(29-18-4-2-17(3-5-18)24(27)28)20(26)23-22-19(25)12-21-9-14-6-15(10-21)8-16(7-14)11-21/h2-5,13-16H,6-12H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | MHHZXLXAFALOQV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|