C22H24N4O6 — CID 4832374
2-(1-adamantyl)-N'-[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]acetohydrazide (PubChem CID 4832374) has the molecular formula C22H24N4O6 and a molecular weight of 440.46 g/mol. Its IUPAC name is 2-(1-adamantyl)-N'-[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]acetohydrazide.
| Compound Name | 2-(1-adamantyl)-N'-[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 4832374 |
| Molecular Formula | C22H24N4O6 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 2-(1-adamantyl)-N'-[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]acetohydrazide |
| SMILES | O=C(CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)NNC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H24N4O6/c27-18(10-22-7-12-3-13(8-22)5-14(4-12)9-22)23-24-19(28)11-25-20(29)16-2-1-15(26(31)32)6-17(16)21(25)30/h1-2,6,12-14H,3-5,7-11H2,(H,23,27)(H,24,28) |
| InChIKey | SFYJMWXZLYSKFU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|