C19H19BrN2O4 — CID 98141031
2-[[(5R,7R)-3-bromo-1-adamantyl]methyl]-5-nitroisoindole-1,3-dione (PubChem CID 98141031) has the molecular formula C19H19BrN2O4 and a molecular weight of 419.28 g/mol. Its IUPAC name is 2-[[(5R,7R)-3-bromo-1-adamantyl]methyl]-5-nitroisoindole-1,3-dione.
| Compound Name | 2-[[(5R,7R)-3-bromo-1-adamantyl]methyl]-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 98141031 |
| Molecular Formula | C19H19BrN2O4 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 2-[[(5R,7R)-3-bromo-1-adamantyl]methyl]-5-nitroisoindole-1,3-dione |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)N1CC12C[C@H]3C[C@@H](CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C19H19BrN2O4/c20-19-7-11-3-12(8-19)6-18(5-11,9-19)10-21-16(23)14-2-1-13(22(25)26)4-15(14)17(21)24/h1-2,4,11-12H,3,5-10H2/t11-,12-,18?,19?/m1/s1 |
| InChIKey | QJNSCGGWXXUQKS-TYGXQLQZSA-N |
| XLogP | 3.92 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|