C15H15BrN4O4S — CID 55451726
4-bromo-1-methyl-N'-[2-(4-nitrophenyl)sulfanylpropanoyl]pyrrole-2-carbohydrazide (PubChem CID 55451726) has the molecular formula C15H15BrN4O4S and a molecular weight of 427.28 g/mol. Its IUPAC name is 4-bromo-1-methyl-N'-[2-(4-nitrophenyl)sulfanylpropanoyl]pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-1-methyl-N'-[2-(4-nitrophenyl)sulfanylpropanoyl]pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 55451726 |
| Molecular Formula | C15H15BrN4O4S |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | 4-bromo-1-methyl-N'-[2-(4-nitrophenyl)sulfanylpropanoyl]pyrrole-2-carbohydrazide |
| SMILES | CC(Sc1ccc([N+](=O)[O-])cc1)C(=O)NNC(=O)c1cc(Br)cn1C |
| InChI | InChI=1S/C15H15BrN4O4S/c1-9(25-12-5-3-11(4-6-12)20(23)24)14(21)17-18-15(22)13-7-10(16)8-19(13)2/h3-9H,1-2H3,(H,17,21)(H,18,22) |
| InChIKey | OKFNIIIXLZYRDX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 106.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|